C24H32O5 — CID 102026886
(7R,8aR,9R,10aR)-1,3-dihydroxy-8a,10a-dimethyl-9-(2-methylpropyl)-7-propan-2-yl-8,9-dihydro-7H-xanthene-2,4-dicarbaldehyde (PubChem CID 102026886) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (7R,8aR,9R,10aR)-1,3-dihydroxy-8a,10a-dimethyl-9-(2-methylpropyl)-7-propan-2-yl-8,9-dihydro-7H-xanthene-2,4-dicarbaldehyde.
| Compound Name | (7R,8aR,9R,10aR)-1,3-dihydroxy-8a,10a-dimethyl-9-(2-methylpropyl)-7-propan-2-yl-8,9-dihydro-7H-xanthene-2,4-dicarbaldehyde |
|---|---|
| PubChem CID | 102026886 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (7R,8aR,9R,10aR)-1,3-dihydroxy-8a,10a-dimethyl-9-(2-methylpropyl)-7-propan-2-yl-8,9-dihydro-7H-xanthene-2,4-dicarbaldehyde |
| SMILES | CC(C)C[C@H]1c2c(O)c(C=O)c(O)c(C=O)c2O[C@]2(C)C=C[C@@H](C(C)C)C[C@]12C |
| InChI | InChI=1S/C24H32O5/c1-13(2)9-18-19-21(28)16(11-25)20(27)17(12-26)22(19)29-24(6)8-7-15(14(3)4)10-23(18,24)5/h7-8,11-15,18,27-28H,9-10H2,1-6H3/t15-,18+,23-,24-/m1/s1 |
| InChIKey | SHCCLCKVNNGCHS-WKRDJKQZSA-N |
| XLogP | 5.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|