C30H24O6 — CID 102026934
8-(4,7-dihydroxy-3-methoxy-9,10-dihydrophenanthren-1-yl)-6-methoxyphenanthrene-2,5-diol (PubChem CID 102026934) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 8-(4,7-dihydroxy-3-methoxy-9,10-dihydrophenanthren-1-yl)-6-methoxyphenanthrene-2,5-diol.
| Compound Name | 8-(4,7-dihydroxy-3-methoxy-9,10-dihydrophenanthren-1-yl)-6-methoxyphenanthrene-2,5-diol |
|---|---|
| PubChem CID | 102026934 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 8-(4,7-dihydroxy-3-methoxy-9,10-dihydrophenanthren-1-yl)-6-methoxyphenanthrene-2,5-diol |
| SMILES | COc1cc(-c2cc(OC)c(O)c3c2ccc2cc(O)ccc23)c2c(c1O)-c1ccc(O)cc1CC2 |
| InChI | InChI=1S/C30H24O6/c1-35-25-13-23(21-7-3-15-11-17(31)5-9-19(15)27(21)29(25)33)24-14-26(36-2)30(34)28-20-10-6-18(32)12-16(20)4-8-22(24)28/h3,5-7,9-14,31-34H,4,8H2,1-2H3 |
| InChIKey | OICWLBYGEMOZNV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|