C25H22N4O3 — CID 10202697
ethyl 11-[(4-methoxyphenyl)methyl]-2,4,10,12-tetrazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),3,5,8,10,12,14,16-octaene-5-carboxylate (PubChem CID 10202697) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is ethyl 11-[(4-methoxyphenyl)methyl]-2,4,10,12-tetrazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),3,5,8,10,12,14,16-octaene-5-carboxylate.
| Compound Name | ethyl 11-[(4-methoxyphenyl)methyl]-2,4,10,12-tetrazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),3,5,8,10,12,14,16-octaene-5-carboxylate |
|---|---|
| PubChem CID | 10202697 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | ethyl 11-[(4-methoxyphenyl)methyl]-2,4,10,12-tetrazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),3,5,8,10,12,14,16-octaene-5-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1Cc1cnc(Cc3ccc(OC)cc3)nc1-c1ccccc1-2 |
| InChI | InChI=1S/C25H22N4O3/c1-3-32-25(30)24-21-13-17-14-26-22(12-16-8-10-18(31-2)11-9-16)28-23(17)19-6-4-5-7-20(19)29(21)15-27-24/h4-11,14-15H,3,12-13H2,1-2H3 |
| InChIKey | VSHSCDYXZNJFAF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |