About 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide
4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 10202758) has the molecular formula C18H16F3N3O4S
and a molecular weight of 427.40 g/mol. Its IUPAC name is 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| PubChem CID | 10202758 |
| Molecular Formula | C18H16F3N3O4S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C18H16F3N3O4S/c1-27-15-8-3-11(9-16(15)28-2)14-10-17(18(19,20)21)23-24(14)12-4-6-13(7-5-12)29(22,25)26/h3-10H,1-2H3,(H2,22,25,26) |
| InChIKey | VNNGIYNQDQOQCJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The IUPAC name of 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CID 10202758) is 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide is COc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1OC.
What is the InChIKey of 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The InChIKey is VNNGIYNQDQOQCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3N3O4S/c1-27-15-8-3-11(9-16(15)28-2)14-10-17(18(19,20)21)23-24(14)12-4-6-13(7-5-12)29(22,25)26/h3-10H,1-2H3,(H2,22,25,26).
What are the key properties of 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide has a molecular weight of 427.40 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,4-dimethoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide is sourced from PubChem (CID 10202758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).