C16H19F2NO2 — CID 102027727
tert-butyl 3,3-difluoro-2-phenyl-2,6-dihydropyridine-1-carboxylate (PubChem CID 102027727) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-2-phenyl-2,6-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 3,3-difluoro-2-phenyl-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 102027727 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | tert-butyl 3,3-difluoro-2-phenyl-2,6-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CC(F)(F)C1c1ccccc1 |
| InChI | InChI=1S/C16H19F2NO2/c1-15(2,3)21-14(20)19-11-7-10-16(17,18)13(19)12-8-5-4-6-9-12/h4-10,13H,11H2,1-3H3 |
| InChIKey | IXYGLTBIRFUXLR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|