C13H25NO4Si — CID 102027770
2-(4-methylcyclohex-3-en-1-yl)-N-(3-trihydroxysilylpropyl)propanamide (PubChem CID 102027770) has the molecular formula C13H25NO4Si and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-(4-methylcyclohex-3-en-1-yl)-N-(3-trihydroxysilylpropyl)propanamide.
| Compound Name | 2-(4-methylcyclohex-3-en-1-yl)-N-(3-trihydroxysilylpropyl)propanamide |
|---|---|
| PubChem CID | 102027770 |
| Molecular Formula | C13H25NO4Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-(4-methylcyclohex-3-en-1-yl)-N-(3-trihydroxysilylpropyl)propanamide |
| SMILES | CC1=CCC(C(C)C(=O)NCCC[Si](O)(O)O)CC1 |
| InChI | InChI=1S/C13H25NO4Si/c1-10-4-6-12(7-5-10)11(2)13(15)14-8-3-9-19(16,17)18/h4,11-12,16-18H,3,5-9H2,1-2H3,(H,14,15) |
| InChIKey | QHBDHKVVEFPATL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|