C9H5ClN4 — CID 102027915
4-chloro-3,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaene (PubChem CID 102027915) has the molecular formula C9H5ClN4 and a molecular weight of 204.62 g/mol. Its IUPAC name is 4-chloro-3,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaene.
| Compound Name | 4-chloro-3,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 102027915 |
| Molecular Formula | C9H5ClN4 |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 4-chloro-3,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaene |
| SMILES | Clc1cnc2nn3ccccc3c2n1 |
| InChI | InChI=1S/C9H5ClN4/c10-7-5-11-9-8(12-7)6-3-1-2-4-14(6)13-9/h1-5H |
| InChIKey | ZGYRKHSGQIWCDD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |