C18H20 — CID 102028127
(1R,8S)-10-phenyltricyclo[6.3.1.02,7]dodeca-2(7),9-diene (PubChem CID 102028127) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1R,8S)-10-phenyltricyclo[6.3.1.02,7]dodeca-2(7),9-diene.
| Compound Name | (1R,8S)-10-phenyltricyclo[6.3.1.02,7]dodeca-2(7),9-diene |
|---|---|
| PubChem CID | 102028127 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1R,8S)-10-phenyltricyclo[6.3.1.02,7]dodeca-2(7),9-diene |
| SMILES | C1=C(c2ccccc2)C[C@H]2C[C@@H]1C1=C2CCCC1 |
| InChI | InChI=1S/C18H20/c1-2-6-13(7-3-1)14-10-15-12-16(11-14)18-9-5-4-8-17(15)18/h1-3,6-7,10,15-16H,4-5,8-9,11-12H2/t15-,16+/m1/s1 |
| InChIKey | NRIWLMPGTRABQE-CVEARBPZSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|