C26H43BrO3Si — CID 102028920
[(3S,3aS,10aS,10bS)-7-bromo-10a-(2-methoxyethoxymethyl)-3a-methyl-8-methylidene-2,3,4,9,10,10b-hexahydro-1H-cyclohepta[e]inden-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102028920) has the molecular formula C26H43BrO3Si and a molecular weight of 511.62 g/mol. Its IUPAC name is [(3S,3aS,10aS,10bS)-7-bromo-10a-(2-methoxyethoxymethyl)-3a-methyl-8-methylidene-2,3,4,9,10,10b-hexahydro-1H-cyclohepta[e]inden-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,3aS,10aS,10bS)-7-bromo-10a-(2-methoxyethoxymethyl)-3a-methyl-8-methylidene-2,3,4,9,10,10b-hexahydro-1H-cyclohepta[e]inden-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102028920 |
| Molecular Formula | C26H43BrO3Si |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | [(3S,3aS,10aS,10bS)-7-bromo-10a-(2-methoxyethoxymethyl)-3a-methyl-8-methylidene-2,3,4,9,10,10b-hexahydro-1H-cyclohepta[e]inden-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CC[C@@]2(COCCOC)C(=CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)C=C1Br |
| InChI | InChI=1S/C26H43BrO3Si/c1-19-11-14-26(18-29-16-15-28-6)20(17-21(19)27)12-13-25(5)22(26)9-10-23(25)30-31(7,8)24(2,3)4/h12,17,22-23H,1,9-11,13-16,18H2,2-8H3/t22-,23+,25+,26-/m1/s1 |
| InChIKey | RCHJQSREYSTOEF-MFYWSIJSSA-N |
| XLogP | 7.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|