C22H16N4O4S3 — CID 102029077
4,9-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 102029077) has the molecular formula C22H16N4O4S3 and a molecular weight of 496.60 g/mol. Its IUPAC name is 4,9-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 102029077 |
| Molecular Formula | C22H16N4O4S3 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 4,9-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | Cc1nc2c(-c3scc4c3OCCO4)c3nsnc3c(-c3scc4c3OCCO4)c2nc1C |
| InChI | InChI=1S/C22H16N4O4S3/c1-9-10(2)24-16-14(22-20-12(8-32-22)28-4-6-30-20)18-17(25-33-26-18)13(15(16)23-9)21-19-11(7-31-21)27-3-5-29-19/h7-8H,3-6H2,1-2H3 |
| InChIKey | BOBBMLSEPMCXDT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |