C12H21NO3 — CID 102029105
(2R,3R,5Z,8R)-2-ethyl-3-hydroxy-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide (PubChem CID 102029105) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (2R,3R,5Z,8R)-2-ethyl-3-hydroxy-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide.
| Compound Name | (2R,3R,5Z,8R)-2-ethyl-3-hydroxy-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
|---|---|
| PubChem CID | 102029105 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (2R,3R,5Z,8R)-2-ethyl-3-hydroxy-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
| SMILES | CC[C@H]1O[C@@H](C(=O)N(C)C)C/C=C\C[C@H]1O |
| InChI | InChI=1S/C12H21NO3/c1-4-10-9(14)7-5-6-8-11(16-10)12(15)13(2)3/h5-6,9-11,14H,4,7-8H2,1-3H3/b6-5-/t9-,10-,11-/m1/s1 |
| InChIKey | BBQWYONEIQKHIU-KJLGVMNDSA-N |
| XLogP | 0.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|