C11H17NO2 — CID 102029198
3-[(1S,8aS)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl]propanal (PubChem CID 102029198) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-[(1S,8aS)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl]propanal.
| Compound Name | 3-[(1S,8aS)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl]propanal |
|---|---|
| PubChem CID | 102029198 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-[(1S,8aS)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-1-yl]propanal |
| SMILES | O=CCC[C@H]1CCN2C(=O)CCC[C@@H]12 |
| InChI | InChI=1S/C11H17NO2/c13-8-2-3-9-6-7-12-10(9)4-1-5-11(12)14/h8-10H,1-7H2/t9-,10-/m0/s1 |
| InChIKey | STKZCAXVNPXBJU-UWVGGRQHSA-N |
| XLogP | 1.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|