C26H25NO8 — CID 102029205
4-[2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalen-2-yl]ethynyl]pyridine-2,6-dicarboxylic acid (PubChem CID 102029205) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is 4-[2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalen-2-yl]ethynyl]pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalen-2-yl]ethynyl]pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 102029205 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-[2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalen-2-yl]ethynyl]pyridine-2,6-dicarboxylic acid |
| SMILES | COCCOCCOCCOc1ccc2cc(C#Cc3cc(C(=O)O)nc(C(=O)O)c3)ccc2c1 |
| InChI | InChI=1S/C26H25NO8/c1-32-8-9-33-10-11-34-12-13-35-22-7-6-20-14-18(4-5-21(20)17-22)2-3-19-15-23(25(28)29)27-24(16-19)26(30)31/h4-7,14-17H,8-13H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | LKERINLDKWZVNE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|