C19H28O3 — CID 102029901
(1S,2Z,7S,10R,11S,15S)-7-hydroxy-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-2-ene-5,14-dione (PubChem CID 102029901) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,2Z,7S,10R,11S,15S)-7-hydroxy-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-2-ene-5,14-dione.
| Compound Name | (1S,2Z,7S,10R,11S,15S)-7-hydroxy-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-2-ene-5,14-dione |
|---|---|
| PubChem CID | 102029901 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,2Z,7S,10R,11S,15S)-7-hydroxy-2,15-dimethyltricyclo[8.7.0.011,15]heptadec-2-ene-5,14-dione |
| SMILES | C/C1=C/CC(=O)C[C@@H](O)CC[C@@H]2[C@@H]1CC[C@]1(C)C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C19H28O3/c1-12-3-4-13(20)11-14(21)5-6-16-15(12)9-10-19(2)17(16)7-8-18(19)22/h3,14-17,21H,4-11H2,1-2H3/b12-3-/t14-,15+,16+,17-,19-/m0/s1 |
| InChIKey | ATZIUUZFLDWAPA-HPRXIOKDSA-N |
| XLogP | 3.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|