C16H25NO6 — CID 102029996
ethyl (E)-5-[2-[formyl-[(E)-5-methoxypent-4-enyl]amino]acetyl]oxypent-2-enoate (PubChem CID 102029996) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl (E)-5-[2-[formyl-[(E)-5-methoxypent-4-enyl]amino]acetyl]oxypent-2-enoate.
| Compound Name | ethyl (E)-5-[2-[formyl-[(E)-5-methoxypent-4-enyl]amino]acetyl]oxypent-2-enoate |
|---|---|
| PubChem CID | 102029996 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | ethyl (E)-5-[2-[formyl-[(E)-5-methoxypent-4-enyl]amino]acetyl]oxypent-2-enoate |
| SMILES | CCOC(=O)/C=C/CCOC(=O)CN(C=O)CCC/C=C/OC |
| InChI | InChI=1S/C16H25NO6/c1-3-22-15(19)9-5-8-12-23-16(20)13-17(14-18)10-6-4-7-11-21-2/h5,7,9,11,14H,3-4,6,8,10,12-13H2,1-2H3/b9-5+,11-7+ |
| InChIKey | CIUDYAFROFCSLD-TWHYHQCRSA-N |
| XLogP | 1.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|