About bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium
bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium (PubChem CID 102030085) has the molecular formula C29H27N2O3P
and a molecular weight of 482.52 g/mol. Its IUPAC name is bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium.
Molecular Properties
| Compound Name | bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium |
| PubChem CID | 102030085 |
| Molecular Formula | C29H27N2O3P |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium |
| SMILES | [O-][PH2+]C(c1cccc(N2COc3ccccc3C2)c1)c1cccc(N2COc3ccccc3C2)c1 |
| InChI | InChI=1S/C29H27N2O3P/c32-35-29(21-9-5-11-25(15-21)30-17-23-7-1-3-13-27(23)33-19-30)22-10-6-12-26(16-22)31-18-24-8-2-4-14-28(24)34-20-31/h1-16,29H,17-20,35H2 |
| InChIKey | CZESIDHXNGDDRR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium?
The IUPAC name of bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium (CID 102030085) is bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium.
What is the SMILES notation for bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium?
The canonical SMILES for bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium is [O-][PH2+]C(c1cccc(N2COc3ccccc3C2)c1)c1cccc(N2COc3ccccc3C2)c1.
What is the InChIKey of bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium?
The InChIKey is CZESIDHXNGDDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27N2O3P/c32-35-29(21-9-5-11-25(15-21)30-17-23-7-1-3-13-27(23)33-19-30)22-10-6-12-26(16-22)31-18-24-8-2-4-14-28(24)34-20-31/h1-16,29H,17-20,35H2.
What are the key properties of bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium?
bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium has a molecular weight of 482.52 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]methyl-oxidophosphanium is sourced from PubChem (CID 102030085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).