C34H50N2O+2 — CID 102030143
1-[4-(3,5-ditert-butylphenoxy)butyl]-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium (PubChem CID 102030143) has the molecular formula C34H50N2O+2 and a molecular weight of 502.79 g/mol. Its IUPAC name is 1-[4-(3,5-ditert-butylphenoxy)butyl]-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium.
| Compound Name | 1-[4-(3,5-ditert-butylphenoxy)butyl]-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 102030143 |
| Molecular Formula | C34H50N2O+2 |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 502.39 |
| IUPAC Name | 1-[4-(3,5-ditert-butylphenoxy)butyl]-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium |
| SMILES | CCCCCC[n+]1ccc(-c2cc[n+](CCCCOc3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C34H50N2O/c1-8-9-10-11-18-35-20-14-28(15-21-35)29-16-22-36(23-17-29)19-12-13-24-37-32-26-30(33(2,3)4)25-31(27-32)34(5,6)7/h14-17,20-23,25-27H,8-13,18-19,24H2,1-7H3/q+2 |
| InChIKey | RQSDKJLPSZCBTM-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|