About diphenyl(propa-1,2-dienyl)silane
diphenyl(propa-1,2-dienyl)silane (PubChem CID 102030268) has the molecular formula C15H14Si
and a molecular weight of 222.36 g/mol. Its IUPAC name is diphenyl(propa-1,2-dienyl)silane.
Molecular Properties
| Compound Name | diphenyl(propa-1,2-dienyl)silane |
| PubChem CID | 102030268 |
| Molecular Formula | C15H14Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | diphenyl(propa-1,2-dienyl)silane |
| SMILES | C=C=C[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14Si/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,1H2 |
| InChIKey | IOCNDBYBWKUSHO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diphenyl(propa-1,2-dienyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl(propa-1,2-dienyl)silane?
The IUPAC name of diphenyl(propa-1,2-dienyl)silane (CID 102030268) is diphenyl(propa-1,2-dienyl)silane.
What is the SMILES notation for diphenyl(propa-1,2-dienyl)silane?
The canonical SMILES for diphenyl(propa-1,2-dienyl)silane is C=C=C[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of diphenyl(propa-1,2-dienyl)silane?
The InChIKey is IOCNDBYBWKUSHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Si/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,1H2.
What are the key properties of diphenyl(propa-1,2-dienyl)silane?
diphenyl(propa-1,2-dienyl)silane has a molecular weight of 222.36 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl(propa-1,2-dienyl)silane is sourced from PubChem (CID 102030268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).