C23H19F2N — CID 102030760
N-[(1R)-1-(3,5-difluorophenyl)but-3-enyl]-1,1-diphenylmethanimine (PubChem CID 102030760) has the molecular formula C23H19F2N and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-difluorophenyl)but-3-enyl]-1,1-diphenylmethanimine.
| Compound Name | N-[(1R)-1-(3,5-difluorophenyl)but-3-enyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 102030760 |
| Molecular Formula | C23H19F2N |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[(1R)-1-(3,5-difluorophenyl)but-3-enyl]-1,1-diphenylmethanimine |
| SMILES | C=CC[C@@H](N=C(c1ccccc1)c1ccccc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H19F2N/c1-2-9-22(19-14-20(24)16-21(25)15-19)26-23(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h2-8,10-16,22H,1,9H2/t22-/m1/s1 |
| InChIKey | SXZARRSUJWQMAG-JOCHJYFZSA-N |
| XLogP | 6.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|