C19H19BrN2O4 — CID 102030956
(3R,6R)-2-(4-bromophenyl)-3-[(1S)-1-nitro-2-phenylethyl]oxazinane-6-carbaldehyde (PubChem CID 102030956) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is (3R,6R)-2-(4-bromophenyl)-3-[(1S)-1-nitro-2-phenylethyl]oxazinane-6-carbaldehyde.
| Compound Name | (3R,6R)-2-(4-bromophenyl)-3-[(1S)-1-nitro-2-phenylethyl]oxazinane-6-carbaldehyde |
|---|---|
| PubChem CID | 102030956 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (3R,6R)-2-(4-bromophenyl)-3-[(1S)-1-nitro-2-phenylethyl]oxazinane-6-carbaldehyde |
| SMILES | O=C[C@H]1CC[C@H]([C@H](Cc2ccccc2)[N+](=O)[O-])N(c2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C19H19BrN2O4/c20-15-6-8-16(9-7-15)21-18(11-10-17(13-23)26-21)19(22(24)25)12-14-4-2-1-3-5-14/h1-9,13,17-19H,10-12H2/t17-,18-,19+/m1/s1 |
| InChIKey | SEMXYGDLCOMDKK-QRVBRYPASA-N |
| XLogP | 3.81 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|