C19H37BO3Si — CID 102031024
tert-butyl-dimethyl-[(3E,5E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-3,5-dienoxy]silane (PubChem CID 102031024) has the molecular formula C19H37BO3Si and a molecular weight of 352.40 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E,5E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-3,5-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3E,5E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-3,5-dienoxy]silane |
|---|---|
| PubChem CID | 102031024 |
| Molecular Formula | C19H37BO3Si |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl-dimethyl-[(3E,5E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-3,5-dienoxy]silane |
| SMILES | C/C(=C/C=C/CCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H37BO3Si/c1-16(20-22-18(5,6)19(7,8)23-20)14-12-11-13-15-21-24(9,10)17(2,3)4/h11-12,14H,13,15H2,1-10H3/b12-11+,16-14- |
| InChIKey | HFTXXTJAOLYYEQ-SCKUGUCZSA-N |
| XLogP | 5.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|