C18H24O7 — CID 102031066
diethyl (1R,5R,7S)-2-(2-methoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate (PubChem CID 102031066) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is diethyl (1R,5R,7S)-2-(2-methoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate.
| Compound Name | diethyl (1R,5R,7S)-2-(2-methoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102031066 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | diethyl (1R,5R,7S)-2-(2-methoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2C[C@H]3C=C[C@@]2(O3)C1CC(=O)OC |
| InChI | InChI=1S/C18H24O7/c1-4-23-15(20)17(16(21)24-5-2)10-11-8-12-6-7-18(11,25-12)13(17)9-14(19)22-3/h6-7,11-13H,4-5,8-10H2,1-3H3/t11-,12+,13?,18-/m0/s1 |
| InChIKey | JRTOHAWMDAONAV-DVKJPYPNSA-N |
| XLogP | 1.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|