C14H22O3Si — CID 102031096
3-(1,3-dioxolan-2-yl)-5-[(3E)-hexa-3,5-dienyl]-2,2-dimethyl-5H-oxasilole (PubChem CID 102031096) has the molecular formula C14H22O3Si and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)-5-[(3E)-hexa-3,5-dienyl]-2,2-dimethyl-5H-oxasilole.
| Compound Name | 3-(1,3-dioxolan-2-yl)-5-[(3E)-hexa-3,5-dienyl]-2,2-dimethyl-5H-oxasilole |
|---|---|
| PubChem CID | 102031096 |
| Molecular Formula | C14H22O3Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)-5-[(3E)-hexa-3,5-dienyl]-2,2-dimethyl-5H-oxasilole |
| SMILES | C=C/C=C/CCC1C=C(C2OCCO2)[Si](C)(C)O1 |
| InChI | InChI=1S/C14H22O3Si/c1-4-5-6-7-8-12-11-13(18(2,3)17-12)14-15-9-10-16-14/h4-6,11-12,14H,1,7-10H2,2-3H3/b6-5+ |
| InChIKey | MIULBLOJGVKWPI-AATRIKPKSA-N |
| XLogP | 2.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|