C24H44O7Si — CID 102031471
(1S,5S,7E,9R,10R,11R,12R,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one (PubChem CID 102031471) has the molecular formula C24H44O7Si and a molecular weight of 472.70 g/mol. Its IUPAC name is (1S,5S,7E,9R,10R,11R,12R,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one.
| Compound Name | (1S,5S,7E,9R,10R,11R,12R,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one |
|---|---|
| PubChem CID | 102031471 |
| Molecular Formula | C24H44O7Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | (1S,5S,7E,9R,10R,11R,12R,13S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,13-dihydroxy-9-methoxy-7,10,12-trimethyl-4,15-dioxabicyclo[9.3.1]pentadec-7-en-3-one |
| SMILES | CO[C@@H]1/C=C(\C)C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)C[C@]2(O)C[C@H](O)[C@@H](C)[C@@H](O2)[C@@H]1C |
| InChI | InChI=1S/C24H44O7Si/c1-15-10-18(14-29-32(8,9)23(4,5)6)30-21(26)13-24(27)12-19(25)16(2)22(31-24)17(3)20(11-15)28-7/h11,16-20,22,25,27H,10,12-14H2,1-9H3/b15-11+/t16-,17-,18+,19+,20-,22-,24+/m1/s1 |
| InChIKey | LJYCXFMOJXCRKV-ISKGFBRBSA-N |
| XLogP | 3.79 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|