C13H25NO — CID 102031623
(4aR,8aR)-8a-(aminomethyl)-8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-4a-ol (PubChem CID 102031623) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (4aR,8aR)-8a-(aminomethyl)-8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-4a-ol.
| Compound Name | (4aR,8aR)-8a-(aminomethyl)-8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 102031623 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (4aR,8aR)-8a-(aminomethyl)-8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-4a-ol |
| SMILES | CC1(C)CCC[C@]2(O)CCCC[C@]12CN |
| InChI | InChI=1S/C13H25NO/c1-11(2)6-5-9-13(15)8-4-3-7-12(11,13)10-14/h15H,3-10,14H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | AJVGHUNYXSDYEL-QWHCGFSZSA-N |
| XLogP | 2.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |