About (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one
(3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one (PubChem CID 102031965) has the molecular formula C23H25NO3
and a molecular weight of 363.46 g/mol. Its IUPAC name is (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one.
Molecular Properties
| Compound Name | (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one |
| PubChem CID | 102031965 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one |
| SMILES | C=CC[C@@]1(COC)OC(=O)[C@](C)(Cc2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C23H25NO3/c1-4-15-23(17-26-3)20(19-13-9-6-10-14-19)24-22(2,21(25)27-23)16-18-11-7-5-8-12-18/h4-14H,1,15-17H2,2-3H3/t22-,23-/m0/s1 |
| InChIKey | SLFCNNNXSJODPA-GOTSBHOMSA-N |
| XLogP | 4.00 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one?
The IUPAC name of (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one (CID 102031965) is (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one.
What is the SMILES notation for (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one?
The canonical SMILES for (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one is C=CC[C@@]1(COC)OC(=O)[C@](C)(Cc2ccccc2)N=C1c1ccccc1.
What is the InChIKey of (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one?
The InChIKey is SLFCNNNXSJODPA-GOTSBHOMSA-N. The full InChI is InChI=1S/C23H25NO3/c1-4-15-23(17-26-3)20(19-13-9-6-10-14-19)24-22(2,21(25)27-23)16-18-11-7-5-8-12-18/h4-14H,1,15-17H2,2-3H3/t22-,23-/m0/s1.
What are the key properties of (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one?
(3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one has a molecular weight of 363.46 g/mol, XLogP of 4.00, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-3-benzyl-6-(methoxymethyl)-3-methyl-5-phenyl-6-prop-2-enyl-1,4-oxazin-2-one is sourced from PubChem (CID 102031965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).