About ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate
ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate (PubChem CID 102032639) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate |
| PubChem CID | 102032639 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate |
| SMILES | C=C[C@@H](C(C)(C)C)[C@]1(C(=O)OCC)OCCC1=O |
| InChI | InChI=1S/C14H22O4/c1-6-10(13(3,4)5)14(12(16)17-7-2)11(15)8-9-18-14/h6,10H,1,7-9H2,2-5H3/t10-,14-/m0/s1 |
| InChIKey | MJOIPFNUXJHACC-HZMBPMFUSA-N |
| XLogP | 2.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate?
The IUPAC name of ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate (CID 102032639) is ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate.
What is the SMILES notation for ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate?
The canonical SMILES for ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate is C=C[C@@H](C(C)(C)C)[C@]1(C(=O)OCC)OCCC1=O.
What is the InChIKey of ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate?
The InChIKey is MJOIPFNUXJHACC-HZMBPMFUSA-N. The full InChI is InChI=1S/C14H22O4/c1-6-10(13(3,4)5)14(12(16)17-7-2)11(15)8-9-18-14/h6,10H,1,7-9H2,2-5H3/t10-,14-/m0/s1.
What are the key properties of ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate?
ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate has a molecular weight of 254.33 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[(3S)-4,4-dimethylpent-1-en-3-yl]-3-oxooxolane-2-carboxylate is sourced from PubChem (CID 102032639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).