C19H33NOSi — CID 102032791
tert-butyl-[(2S,4R,6S)-1,2-dimethyl-6-phenylpiperidin-4-yl]oxy-dimethylsilane (PubChem CID 102032791) has the molecular formula C19H33NOSi and a molecular weight of 319.56 g/mol. Its IUPAC name is tert-butyl-[(2S,4R,6S)-1,2-dimethyl-6-phenylpiperidin-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,4R,6S)-1,2-dimethyl-6-phenylpiperidin-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102032791 |
| Molecular Formula | C19H33NOSi |
| Molecular Weight | 319.56 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | tert-butyl-[(2S,4R,6S)-1,2-dimethyl-6-phenylpiperidin-4-yl]oxy-dimethylsilane |
| SMILES | C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](c2ccccc2)N1C |
| InChI | InChI=1S/C19H33NOSi/c1-15-13-17(21-22(6,7)19(2,3)4)14-18(20(15)5)16-11-9-8-10-12-16/h8-12,15,17-18H,13-14H2,1-7H3/t15-,17+,18-/m0/s1 |
| InChIKey | VRNBEASNAGLORQ-JQHSSLGASA-N |
| XLogP | 5.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|