C14H18O6 — CID 102032876
1,2,3-trimethoxy-4-(2,3,4-trimethoxy-1-tricyclo[1.1.0.02,4]butanyl)tricyclo[1.1.0.02,4]butane (PubChem CID 102032876) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4-(2,3,4-trimethoxy-1-tricyclo[1.1.0.02,4]butanyl)tricyclo[1.1.0.02,4]butane.
| Compound Name | 1,2,3-trimethoxy-4-(2,3,4-trimethoxy-1-tricyclo[1.1.0.02,4]butanyl)tricyclo[1.1.0.02,4]butane |
|---|---|
| PubChem CID | 102032876 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1,2,3-trimethoxy-4-(2,3,4-trimethoxy-1-tricyclo[1.1.0.02,4]butanyl)tricyclo[1.1.0.02,4]butane |
| SMILES | COC12C3(OC)C1(OC)C23C12C3(OC)C1(OC)C32OC |
| InChI | InChI=1S/C14H18O6/c1-15-9-7(10(9,16-2)11(7,9)17-3)8-12(18-4)13(8,19-5)14(8,12)20-6/h1-6H3 |
| InChIKey | HWCWGICPFGSUAX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |