C24H20O — CID 102033544
(2R)-2-[(E,1S)-1,3-diphenylprop-2-enyl]-2,3-dihydroinden-1-one (PubChem CID 102033544) has the molecular formula C24H20O and a molecular weight of 324.42 g/mol. Its IUPAC name is (2R)-2-[(E,1S)-1,3-diphenylprop-2-enyl]-2,3-dihydroinden-1-one.
| Compound Name | (2R)-2-[(E,1S)-1,3-diphenylprop-2-enyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 102033544 |
| Molecular Formula | C24H20O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R)-2-[(E,1S)-1,3-diphenylprop-2-enyl]-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2C[C@@H]1[C@H](/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20O/c25-24-22-14-8-7-13-20(22)17-23(24)21(19-11-5-2-6-12-19)16-15-18-9-3-1-4-10-18/h1-16,21,23H,17H2/b16-15+/t21-,23-/m1/s1 |
| InChIKey | MLCPLZUJRJCFEF-AWZKISCTSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |