About 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one
1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one (PubChem CID 102033569) has the molecular formula C20H32N2O
and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one.
Molecular Properties
| Compound Name | 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one |
| PubChem CID | 102033569 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CC[C@H](N(C)C)[C@@H](Cc2cccc(C)c2)C1 |
| InChI | InChI=1S/C20H32N2O/c1-5-6-10-20(23)22-12-11-19(21(3)4)18(15-22)14-17-9-7-8-16(2)13-17/h7-9,13,18-19H,5-6,10-12,14-15H2,1-4H3/t18-,19-/m0/s1 |
| InChIKey | ALFRBWNDNONREV-OALUTQOASA-N |
| XLogP | 3.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one?
The IUPAC name of 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one (CID 102033569) is 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one.
What is the SMILES notation for 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one?
The canonical SMILES for 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one is CCCCC(=O)N1CC[C@H](N(C)C)[C@@H](Cc2cccc(C)c2)C1.
What is the InChIKey of 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one?
The InChIKey is ALFRBWNDNONREV-OALUTQOASA-N. The full InChI is InChI=1S/C20H32N2O/c1-5-6-10-20(23)22-12-11-19(21(3)4)18(15-22)14-17-9-7-8-16(2)13-17/h7-9,13,18-19H,5-6,10-12,14-15H2,1-4H3/t18-,19-/m0/s1.
What are the key properties of 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one?
1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one has a molecular weight of 316.49 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-4-(dimethylamino)-3-[(3-methylphenyl)methyl]piperidin-1-yl]pentan-1-one is sourced from PubChem (CID 102033569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).