C16H24O4 — CID 102033627
(1R,2R,7R,8R)-1,2,4,4,11,11-hexamethyl-3,12-dioxatricyclo[6.4.0.02,7]dodecane-6,9-dione (PubChem CID 102033627) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1R,2R,7R,8R)-1,2,4,4,11,11-hexamethyl-3,12-dioxatricyclo[6.4.0.02,7]dodecane-6,9-dione.
| Compound Name | (1R,2R,7R,8R)-1,2,4,4,11,11-hexamethyl-3,12-dioxatricyclo[6.4.0.02,7]dodecane-6,9-dione |
|---|---|
| PubChem CID | 102033627 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1R,2R,7R,8R)-1,2,4,4,11,11-hexamethyl-3,12-dioxatricyclo[6.4.0.02,7]dodecane-6,9-dione |
| SMILES | CC1(C)CC(=O)[C@@H]2[C@H]3C(=O)CC(C)(C)O[C@@]3(C)[C@]2(C)O1 |
| InChI | InChI=1S/C16H24O4/c1-13(2)7-9(17)11-12-10(18)8-14(3,4)20-16(12,6)15(11,5)19-13/h11-12H,7-8H2,1-6H3/t11-,12-,15-,16-/m1/s1 |
| InChIKey | KRLMKYNOAYIGRO-CZPYZCIJSA-N |
| XLogP | 2.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |