C13H20O2 — CID 102033631
(1R,2S,4R,9R)-11,11-dimethyl-3-oxatricyclo[7.3.0.02,4]dodecan-7-one (PubChem CID 102033631) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,2S,4R,9R)-11,11-dimethyl-3-oxatricyclo[7.3.0.02,4]dodecan-7-one.
| Compound Name | (1R,2S,4R,9R)-11,11-dimethyl-3-oxatricyclo[7.3.0.02,4]dodecan-7-one |
|---|---|
| PubChem CID | 102033631 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,2S,4R,9R)-11,11-dimethyl-3-oxatricyclo[7.3.0.02,4]dodecan-7-one |
| SMILES | CC1(C)C[C@@H]2CC(=O)CC[C@H]3O[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C13H20O2/c1-13(2)6-8-5-9(14)3-4-11-12(15-11)10(8)7-13/h8,10-12H,3-7H2,1-2H3/t8-,10+,11+,12-/m0/s1 |
| InChIKey | ROVJKMQMXDNUAV-GMNPVEAJSA-N |
| XLogP | 2.56 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|