C22H29BrN2O4 — CID 102034015
(1R,4S,5R,8S,9R,12R,13R)-11-[(4-bromophenyl)methylamino]-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 102034015) has the molecular formula C22H29BrN2O4 and a molecular weight of 465.39 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,12R,13R)-11-[(4-bromophenyl)methylamino]-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,9R,12R,13R)-11-[(4-bromophenyl)methylamino]-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 102034015 |
| Molecular Formula | C22H29BrN2O4 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (1R,4S,5R,8S,9R,12R,13R)-11-[(4-bromophenyl)methylamino]-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(NCc3ccc(Br)cc3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C22H29BrN2O4/c1-13-4-9-18-14(2)19(26)25(24-12-15-5-7-16(23)8-6-15)20-22(18)17(13)10-11-21(3,27-20)28-29-22/h5-8,13-14,17-18,20,24H,4,9-12H2,1-3H3/t13-,14-,17+,18+,20-,21-,22-/m1/s1 |
| InChIKey | IMZMODAKXSFVQS-ZJHNIPSMSA-N |
| XLogP | 4.15 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|