C30H34O12S3 — CID 102034338
[(6R,6aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 102034338) has the molecular formula C30H34O12S3 and a molecular weight of 682.79 g/mol. Its IUPAC name is [(6R,6aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(6R,6aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102034338 |
| Molecular Formula | C30H34O12S3 |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | [(6R,6aR)-2,2-dimethyl-6-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(COS(=O)(=O)c3ccc(C)cc3)OC3OC(C)(C)O[C@@H]3[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H34O12S3/c1-20-6-12-23(13-7-20)43(31,32)37-18-30(19-38-44(33,34)24-14-8-21(2)9-15-24)27(26-28(41-30)40-29(4,5)39-26)42-45(35,36)25-16-10-22(3)11-17-25/h6-17,26-28H,18-19H2,1-5H3/t26-,27-,28?/m1/s1 |
| InChIKey | SJPKBGFGLQZNTB-GORYFVAVSA-N |
| XLogP | 3.74 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|