C14H17FO5 — CID 102034504
(3aR,5S,6S,6aR)-5-[(S)-(4-fluorophenyl)-hydroxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 102034504) has the molecular formula C14H17FO5 and a molecular weight of 284.28 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-5-[(S)-(4-fluorophenyl)-hydroxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5S,6S,6aR)-5-[(S)-(4-fluorophenyl)-hydroxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 102034504 |
| Molecular Formula | C14H17FO5 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (3aR,5S,6S,6aR)-5-[(S)-(4-fluorophenyl)-hydroxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@@H]([C@@H](O)c3ccc(F)cc3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C14H17FO5/c1-14(2)19-12-10(17)11(18-13(12)20-14)9(16)7-3-5-8(15)6-4-7/h3-6,9-13,16-17H,1-2H3/t9-,10-,11-,12+,13+/m0/s1 |
| InChIKey | KFILKCTXGWFTIX-JZRPKSSGSA-N |
| XLogP | 1.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |