C20H18F3N3OS2 — CID 10203455
(3R,5S)-1-(5-thiophen-3-ylpyrimidin-2-yl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol (PubChem CID 10203455) has the molecular formula C20H18F3N3OS2 and a molecular weight of 437.51 g/mol. Its IUPAC name is (3R,5S)-1-(5-thiophen-3-ylpyrimidin-2-yl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol.
| Compound Name | (3R,5S)-1-(5-thiophen-3-ylpyrimidin-2-yl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 10203455 |
| Molecular Formula | C20H18F3N3OS2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (3R,5S)-1-(5-thiophen-3-ylpyrimidin-2-yl)-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol |
| SMILES | Fc1cc(F)c(COC[C@@H]2C[C@@H](S)CN2c2ncc(-c3ccsc3)cn2)cc1F |
| InChI | InChI=1S/C20H18F3N3OS2/c21-17-5-19(23)18(22)3-13(17)9-27-10-15-4-16(28)8-26(15)20-24-6-14(7-25-20)12-1-2-29-11-12/h1-3,5-7,11,15-16,28H,4,8-10H2/t15-,16+/m0/s1 |
| InChIKey | UVUJLMKBKHBROX-JKSUJKDBSA-N |
| XLogP | 4.72 |
| TPSA | 38.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|