C32H62O4Si2 — CID 102034636
(E,5S)-5-[(2R,3S)-3-[(2Z,4S,7E)-3,7-dimethyl-4-triethylsilyloxynona-2,7-dienyl]-2-methyloxiran-2-yl]-2-methyl-5-triethylsilyloxypent-2-en-1-ol (PubChem CID 102034636) has the molecular formula C32H62O4Si2 and a molecular weight of 567.02 g/mol. Its IUPAC name is (E,5S)-5-[(2R,3S)-3-[(2Z,4S,7E)-3,7-dimethyl-4-triethylsilyloxynona-2,7-dienyl]-2-methyloxiran-2-yl]-2-methyl-5-triethylsilyloxypent-2-en-1-ol.
| Compound Name | (E,5S)-5-[(2R,3S)-3-[(2Z,4S,7E)-3,7-dimethyl-4-triethylsilyloxynona-2,7-dienyl]-2-methyloxiran-2-yl]-2-methyl-5-triethylsilyloxypent-2-en-1-ol |
|---|---|
| PubChem CID | 102034636 |
| Molecular Formula | C32H62O4Si2 |
| Molecular Weight | 567.02 g/mol |
| Exact Mass | 566.42 |
| IUPAC Name | (E,5S)-5-[(2R,3S)-3-[(2Z,4S,7E)-3,7-dimethyl-4-triethylsilyloxynona-2,7-dienyl]-2-methyloxiran-2-yl]-2-methyl-5-triethylsilyloxypent-2-en-1-ol |
| SMILES | C/C=C(\C)CC[C@H](O[Si](CC)(CC)CC)/C(C)=C\C[C@@H]1O[C@@]1(C)[C@H](C/C=C(\C)CO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H62O4Si2/c1-12-26(8)19-22-29(35-37(13-2,14-3)15-4)28(10)21-24-30-32(11,34-30)31(23-20-27(9)25-33)36-38(16-5,17-6)18-7/h12,20-21,29-31,33H,13-19,22-25H2,1-11H3/b26-12+,27-20+,28-21-/t29-,30-,31-,32+/m0/s1 |
| InChIKey | CHMTYPHUQYQASZ-AXQQJAQXSA-N |
| XLogP | 9.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.02 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|