C23H36O4 — CID 102034638
2-[(1R,2R,6S,8E,10E,14S)-2,4,4,11,15-pentamethyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-8,10,15-trien-8-yl]propan-2-ol (PubChem CID 102034638) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-[(1R,2R,6S,8E,10E,14S)-2,4,4,11,15-pentamethyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-8,10,15-trien-8-yl]propan-2-ol.
| Compound Name | 2-[(1R,2R,6S,8E,10E,14S)-2,4,4,11,15-pentamethyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-8,10,15-trien-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 102034638 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2-[(1R,2R,6S,8E,10E,14S)-2,4,4,11,15-pentamethyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-8,10,15-trien-8-yl]propan-2-ol |
| SMILES | CC1=CC[C@H]2O[C@H]1CC/C(C)=C/C=C(/C(C)(C)O)C[C@@H]1OC(C)(C)O[C@@]12C |
| InChI | InChI=1S/C23H36O4/c1-15-8-11-17(21(3,4)24)14-20-23(7,27-22(5,6)26-20)19-13-10-16(2)18(25-19)12-9-15/h8,10-11,18-20,24H,9,12-14H2,1-7H3/b15-8+,17-11+/t18-,19+,20-,23+/m0/s1 |
| InChIKey | CGBKUBQXKARVHI-CAEDZTFUSA-N |
| XLogP | 4.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|