C17H26O5 — CID 102034773
[(1S,2R,3aR,4S,6R)-7-formyl-2-hydroxy-1-(hydroxymethyl)-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate (PubChem CID 102034773) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [(1S,2R,3aR,4S,6R)-7-formyl-2-hydroxy-1-(hydroxymethyl)-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate.
| Compound Name | [(1S,2R,3aR,4S,6R)-7-formyl-2-hydroxy-1-(hydroxymethyl)-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 102034773 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(1S,2R,3aR,4S,6R)-7-formyl-2-hydroxy-1-(hydroxymethyl)-1,3,3,6-tetramethyl-3a,4,5,6-tetrahydro-2H-inden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)C(C=O)=C2[C@@H]1C(C)(C)[C@@H](O)[C@]2(C)CO |
| InChI | InChI=1S/C17H26O5/c1-9-6-12(22-10(2)20)14-13(11(9)7-18)17(5,8-19)15(21)16(14,3)4/h7,9,12,14-15,19,21H,6,8H2,1-5H3/t9-,12+,14-,15-,17-/m1/s1 |
| InChIKey | LCAFIAWKWPMFHH-RTNSRKOKSA-N |
| XLogP | 1.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|