C25H40N4S2 — CID 102034966
1-(1-adamantyl)-3-[3-(1-adamantylcarbamothioylamino)propyl]thiourea (PubChem CID 102034966) has the molecular formula C25H40N4S2 and a molecular weight of 460.76 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-(1-adamantylcarbamothioylamino)propyl]thiourea.
| Compound Name | 1-(1-adamantyl)-3-[3-(1-adamantylcarbamothioylamino)propyl]thiourea |
|---|---|
| PubChem CID | 102034966 |
| Molecular Formula | C25H40N4S2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-(1-adamantylcarbamothioylamino)propyl]thiourea |
| SMILES | S=C(NCCCNC(=S)NC12CC3CC(CC(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H40N4S2/c30-22(28-24-10-16-4-17(11-24)6-18(5-16)12-24)26-2-1-3-27-23(31)29-25-13-19-7-20(14-25)9-21(8-19)15-25/h16-21H,1-15H2,(H2,26,28,30)(H2,27,29,31) |
| InChIKey | GCVSKAUZWGVCQQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|