C11H15N — CID 102035380
(1S,2S,7R,8R)-tricyclo[6.2.1.02,7]undec-9-en-11-imine (PubChem CID 102035380) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (1S,2S,7R,8R)-tricyclo[6.2.1.02,7]undec-9-en-11-imine.
| Compound Name | (1S,2S,7R,8R)-tricyclo[6.2.1.02,7]undec-9-en-11-imine |
|---|---|
| PubChem CID | 102035380 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (1S,2S,7R,8R)-tricyclo[6.2.1.02,7]undec-9-en-11-imine |
| SMILES | [H]/N=C1/[C@H]2C=C[C@@H]1[C@@H]1CCCC[C@@H]12 |
| InChI | InChI=1S/C11H15N/c12-11-9-5-6-10(11)8-4-2-1-3-7(8)9/h5-10,12H,1-4H2/b12-11-/t7-,8+,9-,10+/m0/s1 |
| InChIKey | OMUGHVHJAWVLSO-IWWJHWEOSA-N |
| XLogP | 2.63 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|