About 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal
2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal (PubChem CID 102035427) has the molecular formula C10H18OSi
and a molecular weight of 182.34 g/mol. Its IUPAC name is 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal |
| PubChem CID | 102035427 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal |
| SMILES | C=C=C(C(C)(C)C=O)[Si](C)(C)C |
| InChI | InChI=1S/C10H18OSi/c1-7-9(12(4,5)6)10(2,3)8-11/h8H,1H2,2-6H3 |
| InChIKey | BKGGOXFQCXVVSO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal?
The IUPAC name of 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal (CID 102035427) is 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal.
What is the SMILES notation for 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal?
The canonical SMILES for 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal is C=C=C(C(C)(C)C=O)[Si](C)(C)C.
What is the InChIKey of 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal?
The InChIKey is BKGGOXFQCXVVSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OSi/c1-7-9(12(4,5)6)10(2,3)8-11/h8H,1H2,2-6H3.
What are the key properties of 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal?
2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal has a molecular weight of 182.34 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-trimethylsilylpenta-3,4-dienal is sourced from PubChem (CID 102035427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).