C13H10N4S — CID 102035630
6-(phenyliminomethyl)thieno[2,3-b]pyrazin-7-amine (PubChem CID 102035630) has the molecular formula C13H10N4S and a molecular weight of 254.32 g/mol. Its IUPAC name is 6-(phenyliminomethyl)thieno[2,3-b]pyrazin-7-amine.
| Compound Name | 6-(phenyliminomethyl)thieno[2,3-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 102035630 |
| Molecular Formula | C13H10N4S |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 6-(phenyliminomethyl)thieno[2,3-b]pyrazin-7-amine |
| SMILES | Nc1c(/C=N/c2ccccc2)sc2nccnc12 |
| InChI | InChI=1S/C13H10N4S/c14-11-10(8-17-9-4-2-1-3-5-9)18-13-12(11)15-6-7-16-13/h1-8H,14H2/b17-8+ |
| InChIKey | IGUFWYDQRVLATG-CAOOACKPSA-N |
| XLogP | 3.02 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|