C9H15NO2 — CID 102036186
(8aS)-3,3-dimethyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one (PubChem CID 102036186) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (8aS)-3,3-dimethyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one.
| Compound Name | (8aS)-3,3-dimethyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 102036186 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (8aS)-3,3-dimethyl-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one |
| SMILES | CC1(C)OC[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C9H15NO2/c1-9(2)8(11)10-5-3-4-7(10)6-12-9/h7H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | JCKFEEOWHROZLA-ZETCQYMHSA-N |
| XLogP | 0.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |