C20H32O3Si — CID 102036590
(4aS,5S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,6,8a-tetramethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 102036590) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (4aS,5S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,6,8a-tetramethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,5S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,6,8a-tetramethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 102036590 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (4aS,5S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,5,6,8a-tetramethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | CC1=CC(=O)[C@H]2[C@H](C)C(C)=C(O[Si](C)(C)C(C)(C)C)C[C@]2(C)C1=O |
| InChI | InChI=1S/C20H32O3Si/c1-12-10-15(21)17-14(3)13(2)16(11-20(17,7)18(12)22)23-24(8,9)19(4,5)6/h10,14,17H,11H2,1-9H3/t14-,17-,20+/m1/s1 |
| InChIKey | FJOOESIHVYZRRF-ZTQAJYAQSA-N |
| XLogP | 5.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|