C16H29BO2 — CID 102036850
2-[(1E,3R,4E)-3,7-dimethylocta-1,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102036850) has the molecular formula C16H29BO2 and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-[(1E,3R,4E)-3,7-dimethylocta-1,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1E,3R,4E)-3,7-dimethylocta-1,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102036850 |
| Molecular Formula | C16H29BO2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 2-[(1E,3R,4E)-3,7-dimethylocta-1,4-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)C/C=C/[C@H](C)/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H29BO2/c1-13(2)9-8-10-14(3)11-12-17-18-15(4,5)16(6,7)19-17/h8,10-14H,9H2,1-7H3/b10-8+,12-11+/t14-/m0/s1 |
| InChIKey | TWEQQIKWJTYYOH-XJYSWKOESA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|