About 5-azido-5-phenylpentanal
5-azido-5-phenylpentanal (PubChem CID 102037559) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-azido-5-phenylpentanal.
Molecular Properties
| Compound Name | 5-azido-5-phenylpentanal |
| PubChem CID | 102037559 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-azido-5-phenylpentanal |
| SMILES | [N-]=[N+]=NC(CCCC=O)c1ccccc1 |
| InChI | InChI=1S/C11H13N3O/c12-14-13-11(8-4-5-9-15)10-6-2-1-3-7-10/h1-3,6-7,9,11H,4-5,8H2 |
| InChIKey | BHYKGDDPXZAEDA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-5-phenylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-5-phenylpentanal?
The IUPAC name of 5-azido-5-phenylpentanal (CID 102037559) is 5-azido-5-phenylpentanal.
What is the SMILES notation for 5-azido-5-phenylpentanal?
The canonical SMILES for 5-azido-5-phenylpentanal is [N-]=[N+]=NC(CCCC=O)c1ccccc1.
What is the InChIKey of 5-azido-5-phenylpentanal?
The InChIKey is BHYKGDDPXZAEDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c12-14-13-11(8-4-5-9-15)10-6-2-1-3-7-10/h1-3,6-7,9,11H,4-5,8H2.
What are the key properties of 5-azido-5-phenylpentanal?
5-azido-5-phenylpentanal has a molecular weight of 203.25 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-5-phenylpentanal is sourced from PubChem (CID 102037559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).