C17H20OS — CID 102037620
(6R)-2,6-dimethyl-3-phenylsulfanyl-6-[(E)-prop-1-enyl]cyclohex-2-en-1-one (PubChem CID 102037620) has the molecular formula C17H20OS and a molecular weight of 272.41 g/mol. Its IUPAC name is (6R)-2,6-dimethyl-3-phenylsulfanyl-6-[(E)-prop-1-enyl]cyclohex-2-en-1-one.
| Compound Name | (6R)-2,6-dimethyl-3-phenylsulfanyl-6-[(E)-prop-1-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102037620 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (6R)-2,6-dimethyl-3-phenylsulfanyl-6-[(E)-prop-1-enyl]cyclohex-2-en-1-one |
| SMILES | C/C=C/[C@@]1(C)CCC(Sc2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C17H20OS/c1-4-11-17(3)12-10-15(13(2)16(17)18)19-14-8-6-5-7-9-14/h4-9,11H,10,12H2,1-3H3/b11-4+/t17-/m0/s1 |
| InChIKey | DEYDYODQIHJNFU-ITHMCKDVSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|