C24H30N2O4S — CID 10203780
methyl 6-[3-(4-methylphenyl)-2-propylsulfinylbenzimidazol-5-yl]oxyhexanoate (PubChem CID 10203780) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is methyl 6-[3-(4-methylphenyl)-2-propylsulfinylbenzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[3-(4-methylphenyl)-2-propylsulfinylbenzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10203780 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | methyl 6-[3-(4-methylphenyl)-2-propylsulfinylbenzimidazol-5-yl]oxyhexanoate |
| SMILES | CCCS(=O)c1nc2ccc(OCCCCCC(=O)OC)cc2n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-4-16-31(28)24-25-21-14-13-20(30-15-7-5-6-8-23(27)29-3)17-22(21)26(24)19-11-9-18(2)10-12-19/h9-14,17H,4-8,15-16H2,1-3H3 |
| InChIKey | JADYJBXRLJTMSF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|